C23H28N6O3 — CID 42655687
butyl 4-[[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-3-carbonyl]amino]benzoate (PubChem CID 42655687) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is butyl 4-[[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-3-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 42655687 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | butyl 4-[[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-3-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2CCCN(c3ccc4nnc(C)n4n3)C2)cc1 |
| InChI | InChI=1S/C23H28N6O3/c1-3-4-14-32-23(31)17-7-9-19(10-8-17)24-22(30)18-6-5-13-28(15-18)21-12-11-20-26-25-16(2)29(20)27-21/h7-12,18H,3-6,13-15H2,1-2H3,(H,24,30) |
| InChIKey | VQGJUZNMBJUWMF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|