C21H20FN3O4 — CID 42655979
N-[2-(3-acetylanilino)-2-oxoethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 42655979) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is N-[2-(3-acetylanilino)-2-oxoethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[2-(3-acetylanilino)-2-oxoethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42655979 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[2-(3-acetylanilino)-2-oxoethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)CNC(=O)C2CC(=O)N(c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C21H20FN3O4/c1-13(26)14-3-2-4-17(9-14)24-19(27)11-23-21(29)15-10-20(28)25(12-15)18-7-5-16(22)6-8-18/h2-9,15H,10-12H2,1H3,(H,23,29)(H,24,27) |
| InChIKey | SGMBEHBYQHIZPJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |