C19H17BrFN3O3 — CID 39342065
(3R)-N-[2-(2-bromoanilino)-2-oxoethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 39342065) has the molecular formula C19H17BrFN3O3 and a molecular weight of 434.27 g/mol. Its IUPAC name is (3R)-N-[2-(2-bromoanilino)-2-oxoethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(2-bromoanilino)-2-oxoethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 39342065 |
| Molecular Formula | C19H17BrFN3O3 |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | (3R)-N-[2-(2-bromoanilino)-2-oxoethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(CNC(=O)[C@@H]1CC(=O)N(c2ccc(F)cc2)C1)Nc1ccccc1Br |
| InChI | InChI=1S/C19H17BrFN3O3/c20-15-3-1-2-4-16(15)23-17(25)10-22-19(27)12-9-18(26)24(11-12)14-7-5-13(21)6-8-14/h1-8,12H,9-11H2,(H,22,27)(H,23,25)/t12-/m1/s1 |
| InChIKey | BSAHNQHZUKPYEM-GFCCVEGCSA-N |
| XLogP | 2.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |