C29H31ClN2O — CID 42657083
1-butyl-1-[(10-chloroanthracen-9-yl)methyl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 42657083) has the molecular formula C29H31ClN2O and a molecular weight of 459.03 g/mol. Its IUPAC name is 1-butyl-1-[(10-chloroanthracen-9-yl)methyl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-butyl-1-[(10-chloroanthracen-9-yl)methyl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 42657083 |
| Molecular Formula | C29H31ClN2O |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1-butyl-1-[(10-chloroanthracen-9-yl)methyl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | CCCCN(Cc1c2ccccc2c(Cl)c2ccccc12)C(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C29H31ClN2O/c1-4-5-18-32(29(33)31-22-16-14-21(15-17-22)20(2)3)19-27-23-10-6-8-12-25(23)28(30)26-13-9-7-11-24(26)27/h6-17,20H,4-5,18-19H2,1-3H3,(H,31,33) |
| InChIKey | SKYVJJCZAIZSEW-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|