C35H28N4O4 — CID 42657662
N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]-3-nitro-N-(2-phenylethyl)benzamide (PubChem CID 42657662) has the molecular formula C35H28N4O4 and a molecular weight of 568.63 g/mol. Its IUPAC name is N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]-3-nitro-N-(2-phenylethyl)benzamide.
| Compound Name | N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]-3-nitro-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42657662 |
| Molecular Formula | C35H28N4O4 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]-3-nitro-N-(2-phenylethyl)benzamide |
| SMILES | CC(c1nc2ccccc2c(=O)n1-c1ccc2ccccc2c1)N(CCc1ccccc1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C35H28N4O4/c1-24(37(21-20-25-10-3-2-4-11-25)34(40)28-14-9-15-30(23-28)39(42)43)33-36-32-17-8-7-16-31(32)35(41)38(33)29-19-18-26-12-5-6-13-27(26)22-29/h2-19,22-24H,20-21H2,1H3 |
| InChIKey | WFSIHECMBAOWCK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|