C29H32FN3O2 — CID 42659622
N-cyclopropyl-N-[2-[4-(4-fluorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]heptanamide (PubChem CID 42659622) has the molecular formula C29H32FN3O2 and a molecular weight of 473.59 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-[4-(4-fluorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]heptanamide.
| Compound Name | N-cyclopropyl-N-[2-[4-(4-fluorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]heptanamide |
|---|---|
| PubChem CID | 42659622 |
| Molecular Formula | C29H32FN3O2 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | N-cyclopropyl-N-[2-[4-(4-fluorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]heptanamide |
| SMILES | CCCCCCC(=O)N(CC(=O)N1c2ccccc2-n2cccc2C1c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C29H32FN3O2/c1-2-3-4-5-12-27(34)32(23-17-18-23)20-28(35)33-25-10-7-6-9-24(25)31-19-8-11-26(31)29(33)21-13-15-22(30)16-14-21/h6-11,13-16,19,23,29H,2-5,12,17-18,20H2,1H3 |
| InChIKey | MMHLWFLIWSVTCI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|