C33H32FN3O3 — CID 42659625
4-butoxy-N-cyclopropyl-N-[2-[4-(4-fluorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]benzamide (PubChem CID 42659625) has the molecular formula C33H32FN3O3 and a molecular weight of 537.64 g/mol. Its IUPAC name is 4-butoxy-N-cyclopropyl-N-[2-[4-(4-fluorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-butoxy-N-cyclopropyl-N-[2-[4-(4-fluorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 42659625 |
| Molecular Formula | C33H32FN3O3 |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 4-butoxy-N-cyclopropyl-N-[2-[4-(4-fluorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CC(=O)N2c3ccccc3-n3cccc3C2c2ccc(F)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C33H32FN3O3/c1-2-3-21-40-27-18-12-24(13-19-27)33(39)36(26-16-17-26)22-31(38)37-29-8-5-4-7-28(29)35-20-6-9-30(35)32(37)23-10-14-25(34)15-11-23/h4-15,18-20,26,32H,2-3,16-17,21-22H2,1H3 |
| InChIKey | GTXQLNHIOVSJIV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|