C20H19N5O6S2 — CID 42662418
N-[5-(3-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-1-(4-nitrophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 42662418) has the molecular formula C20H19N5O6S2 and a molecular weight of 489.54 g/mol. Its IUPAC name is N-[5-(3-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-1-(4-nitrophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[5-(3-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-1-(4-nitrophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42662418 |
| Molecular Formula | C20H19N5O6S2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | N-[5-(3-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-1-(4-nitrophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | COc1cccc(-c2nnc(NC(=O)C3CCCN3S(=O)(=O)c3ccc([N+](=O)[O-])cc3)s2)c1 |
| InChI | InChI=1S/C20H19N5O6S2/c1-31-15-5-2-4-13(12-15)19-22-23-20(32-19)21-18(26)17-6-3-11-24(17)33(29,30)16-9-7-14(8-10-16)25(27)28/h2,4-5,7-10,12,17H,3,6,11H2,1H3,(H,21,23,26) |
| InChIKey | AYRQIIKTDIVTMB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|