C25H20N6O6S — CID 42663244
N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-2-[(4-nitrophenyl)carbamoylamino]-3-phenylpropanamide (PubChem CID 42663244) has the molecular formula C25H20N6O6S and a molecular weight of 532.54 g/mol. Its IUPAC name is N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-2-[(4-nitrophenyl)carbamoylamino]-3-phenylpropanamide.
| Compound Name | N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-2-[(4-nitrophenyl)carbamoylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 42663244 |
| Molecular Formula | C25H20N6O6S |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | N-[5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-2-[(4-nitrophenyl)carbamoylamino]-3-phenylpropanamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)NC(Cc1ccccc1)C(=O)Nc1nnc(-c2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C25H20N6O6S/c32-22(28-25-30-29-23(38-25)16-6-11-20-21(13-16)37-14-36-20)19(12-15-4-2-1-3-5-15)27-24(33)26-17-7-9-18(10-8-17)31(34)35/h1-11,13,19H,12,14H2,(H2,26,27,33)(H,28,30,32) |
| InChIKey | STVMMYYTHSLBDB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 157.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|