C37H40N4O3 — CID 42663449
3-[4-(4-benzhydrylpiperazine-1-carbonyl)anilino]-2-(3-ethoxypropyl)-3H-isoindol-1-one (PubChem CID 42663449) has the molecular formula C37H40N4O3 and a molecular weight of 588.75 g/mol. Its IUPAC name is 3-[4-(4-benzhydrylpiperazine-1-carbonyl)anilino]-2-(3-ethoxypropyl)-3H-isoindol-1-one.
| Compound Name | 3-[4-(4-benzhydrylpiperazine-1-carbonyl)anilino]-2-(3-ethoxypropyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 42663449 |
| Molecular Formula | C37H40N4O3 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 3-[4-(4-benzhydrylpiperazine-1-carbonyl)anilino]-2-(3-ethoxypropyl)-3H-isoindol-1-one |
| SMILES | CCOCCCN1C(=O)c2ccccc2C1Nc1ccc(C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C37H40N4O3/c1-2-44-27-11-22-41-35(32-16-9-10-17-33(32)37(41)43)38-31-20-18-30(19-21-31)36(42)40-25-23-39(24-26-40)34(28-12-5-3-6-13-28)29-14-7-4-8-15-29/h3-10,12-21,34-35,38H,2,11,22-27H2,1H3 |
| InChIKey | XZXGILBNFCRPBX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|