C32H37N3O3 — CID 42766347
3-[3-(4-benzylpiperidine-1-carbonyl)anilino]-2-(3-ethoxypropyl)-3H-isoindol-1-one (PubChem CID 42766347) has the molecular formula C32H37N3O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is 3-[3-(4-benzylpiperidine-1-carbonyl)anilino]-2-(3-ethoxypropyl)-3H-isoindol-1-one.
| Compound Name | 3-[3-(4-benzylpiperidine-1-carbonyl)anilino]-2-(3-ethoxypropyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 42766347 |
| Molecular Formula | C32H37N3O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | 3-[3-(4-benzylpiperidine-1-carbonyl)anilino]-2-(3-ethoxypropyl)-3H-isoindol-1-one |
| SMILES | CCOCCCN1C(=O)c2ccccc2C1Nc1cccc(C(=O)N2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C32H37N3O3/c1-2-38-21-9-18-35-30(28-14-6-7-15-29(28)32(35)37)33-27-13-8-12-26(23-27)31(36)34-19-16-25(17-20-34)22-24-10-4-3-5-11-24/h3-8,10-15,23,25,30,33H,2,9,16-22H2,1H3 |
| InChIKey | HTCZFGCNQBWDQI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|