C29H42N4O3 — CID 4316464
N-[5-(diethylamino)pentan-2-yl]-3-[[2-(3-ethoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide (PubChem CID 4316464) has the molecular formula C29H42N4O3 and a molecular weight of 494.68 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-3-[[2-(3-ethoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-3-[[2-(3-ethoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide |
|---|---|
| PubChem CID | 4316464 |
| Molecular Formula | C29H42N4O3 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-3-[[2-(3-ethoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide |
| SMILES | CCOCCCN1C(=O)c2ccccc2C1Nc1cccc(C(=O)NC(C)CCCN(CC)CC)c1 |
| InChI | InChI=1S/C29H42N4O3/c1-5-32(6-2)18-11-13-22(4)30-28(34)23-14-10-15-24(21-23)31-27-25-16-8-9-17-26(25)29(35)33(27)19-12-20-36-7-3/h8-10,14-17,21-22,27,31H,5-7,11-13,18-20H2,1-4H3,(H,30,34) |
| InChIKey | GIBXNAXZESATEV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|