C27H29N3O3 — CID 42766329
N-(3,4-dimethylphenyl)-3-[[2-(3-methoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide (PubChem CID 42766329) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3-[[2-(3-methoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide.
| Compound Name | N-(3,4-dimethylphenyl)-3-[[2-(3-methoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide |
|---|---|
| PubChem CID | 42766329 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3-[[2-(3-methoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide |
| SMILES | COCCCN1C(=O)c2ccccc2C1Nc1cccc(C(=O)Nc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C27H29N3O3/c1-18-12-13-22(16-19(18)2)29-26(31)20-8-6-9-21(17-20)28-25-23-10-4-5-11-24(23)27(32)30(25)14-7-15-33-3/h4-6,8-13,16-17,25,28H,7,14-15H2,1-3H3,(H,29,31) |
| InChIKey | UWOSOXJWFUSJBD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|