C28H31N3O3 — CID 42663625
3-[[2-(4-ethoxyphenyl)-3-oxo-1H-isoindol-1-yl]amino]-N-(3-methylbutyl)benzamide (PubChem CID 42663625) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-[[2-(4-ethoxyphenyl)-3-oxo-1H-isoindol-1-yl]amino]-N-(3-methylbutyl)benzamide.
| Compound Name | 3-[[2-(4-ethoxyphenyl)-3-oxo-1H-isoindol-1-yl]amino]-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 42663625 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 3-[[2-(4-ethoxyphenyl)-3-oxo-1H-isoindol-1-yl]amino]-N-(3-methylbutyl)benzamide |
| SMILES | CCOc1ccc(N2C(=O)c3ccccc3C2Nc2cccc(C(=O)NCCC(C)C)c2)cc1 |
| InChI | InChI=1S/C28H31N3O3/c1-4-34-23-14-12-22(13-15-23)31-26(24-10-5-6-11-25(24)28(31)33)30-21-9-7-8-20(18-21)27(32)29-17-16-19(2)3/h5-15,18-19,26,30H,4,16-17H2,1-3H3,(H,29,32) |
| InChIKey | MSGFASUHZNUFHK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |