C29H26N4O3 — CID 42765917
3-[[2-(4-ethoxyphenyl)-3-oxo-1H-isoindol-1-yl]amino]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 42765917) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is 3-[[2-(4-ethoxyphenyl)-3-oxo-1H-isoindol-1-yl]amino]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 3-[[2-(4-ethoxyphenyl)-3-oxo-1H-isoindol-1-yl]amino]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42765917 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 3-[[2-(4-ethoxyphenyl)-3-oxo-1H-isoindol-1-yl]amino]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCOc1ccc(N2C(=O)c3ccccc3C2Nc2cccc(C(=O)NCc3cccnc3)c2)cc1 |
| InChI | InChI=1S/C29H26N4O3/c1-2-36-24-14-12-23(13-15-24)33-27(25-10-3-4-11-26(25)29(33)35)32-22-9-5-8-21(17-22)28(34)31-19-20-7-6-16-30-18-20/h3-18,27,32H,2,19H2,1H3,(H,31,34) |
| InChIKey | UTBXFHCOXWUJEP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |