C28H32N4O4S2 — CID 42666518
2-[1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-oxopropan-2-yl]sulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 42666518) has the molecular formula C28H32N4O4S2 and a molecular weight of 552.72 g/mol. Its IUPAC name is 2-[1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-oxopropan-2-yl]sulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-oxopropan-2-yl]sulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42666518 |
| Molecular Formula | C28H32N4O4S2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 2-[1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-oxopropan-2-yl]sulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SC(C)C(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C28H32N4O4S2/c1-3-10-32-27(34)24-20-6-4-5-7-23(20)38-25(24)29-28(32)37-18(2)26(33)31-13-11-30(12-14-31)16-19-8-9-21-22(15-19)36-17-35-21/h3,8-9,15,18H,1,4-7,10-14,16-17H2,2H3 |
| InChIKey | INOSCTKXJANZJG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|