C24H25N3O4S2 — CID 4790622
N-(1,3-benzodioxol-5-yl)-2-[(3-oxo-4-prop-2-enyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-5-yl)sulfanyl]propanamide (PubChem CID 4790622) has the molecular formula C24H25N3O4S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(3-oxo-4-prop-2-enyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-5-yl)sulfanyl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(3-oxo-4-prop-2-enyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-5-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 4790622 |
| Molecular Formula | C24H25N3O4S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(3-oxo-4-prop-2-enyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-5-yl)sulfanyl]propanamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2ccc3c(c2)OCO3)nc2sc3c(c2c1=O)CCCCC3 |
| InChI | InChI=1S/C24H25N3O4S2/c1-3-11-27-23(29)20-16-7-5-4-6-8-19(16)33-22(20)26-24(27)32-14(2)21(28)25-15-9-10-17-18(12-15)31-13-30-17/h3,9-10,12,14H,1,4-8,11,13H2,2H3,(H,25,28) |
| InChIKey | ZXXLWAFSHRKBRX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|