C18H14FN3O5S2 — CID 4266771
N-[3-ethyl-5-[(3-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide (PubChem CID 4266771) has the molecular formula C18H14FN3O5S2 and a molecular weight of 435.46 g/mol. Its IUPAC name is N-[3-ethyl-5-[(3-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide.
| Compound Name | N-[3-ethyl-5-[(3-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 4266771 |
| Molecular Formula | C18H14FN3O5S2 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | N-[3-ethyl-5-[(3-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
| SMILES | CCN1C(=O)C(=Cc2cccc([N+](=O)[O-])c2)SC1=NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FN3O5S2/c1-2-21-17(23)16(11-12-4-3-5-14(10-12)22(24)25)28-18(21)20-29(26,27)15-8-6-13(19)7-9-15/h3-11H,2H2,1H3 |
| InChIKey | HUHGTBSDFCCVAR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 109.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|