C21H21ClN6O3S — CID 42674188
N-[2-[[1-(2-chlorophenyl)-6-(methoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 42674188) has the molecular formula C21H21ClN6O3S and a molecular weight of 472.96 g/mol. Its IUPAC name is N-[2-[[1-(2-chlorophenyl)-6-(methoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[[1-(2-chlorophenyl)-6-(methoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42674188 |
| Molecular Formula | C21H21ClN6O3S |
| Molecular Weight | 472.96 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | N-[2-[[1-(2-chlorophenyl)-6-(methoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | COCc1nc(NCCNS(=O)(=O)c2ccccc2)c2cnn(-c3ccccc3Cl)c2n1 |
| InChI | InChI=1S/C21H21ClN6O3S/c1-31-14-19-26-20(23-11-12-25-32(29,30)15-7-3-2-4-8-15)16-13-24-28(21(16)27-19)18-10-6-5-9-17(18)22/h2-10,13,25H,11-12,14H2,1H3,(H,23,26,27) |
| InChIKey | KUDBRMYGVWEPTH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.96 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|