C12H16N8OS — CID 56905663
6-(methoxymethyl)-1-methyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 56905663) has the molecular formula C12H16N8OS and a molecular weight of 320.38 g/mol. Its IUPAC name is 6-(methoxymethyl)-1-methyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-(methoxymethyl)-1-methyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56905663 |
| Molecular Formula | C12H16N8OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 6-(methoxymethyl)-1-methyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COCc1nc(NCCSc2cn[nH]n2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C12H16N8OS/c1-20-12-8(5-15-20)11(16-9(17-12)7-21-2)13-3-4-22-10-6-14-19-18-10/h5-6H,3-4,7H2,1-2H3,(H,13,16,17)(H,14,18,19) |
| InChIKey | CMKVLCVQUIBIEI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|