C21H26N2O4S — CID 42674306
ethyl 1-ethyl-3,5-dimethyl-4-[2-[prop-2-enyl(thiophene-2-carbonyl)amino]acetyl]pyrrole-2-carboxylate (PubChem CID 42674306) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is ethyl 1-ethyl-3,5-dimethyl-4-[2-[prop-2-enyl(thiophene-2-carbonyl)amino]acetyl]pyrrole-2-carboxylate.
| Compound Name | ethyl 1-ethyl-3,5-dimethyl-4-[2-[prop-2-enyl(thiophene-2-carbonyl)amino]acetyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42674306 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | ethyl 1-ethyl-3,5-dimethyl-4-[2-[prop-2-enyl(thiophene-2-carbonyl)amino]acetyl]pyrrole-2-carboxylate |
| SMILES | C=CCN(CC(=O)c1c(C)c(C(=O)OCC)n(CC)c1C)C(=O)c1cccs1 |
| InChI | InChI=1S/C21H26N2O4S/c1-6-11-22(20(25)17-10-9-12-28-17)13-16(24)18-14(4)19(21(26)27-8-3)23(7-2)15(18)5/h6,9-10,12H,1,7-8,11,13H2,2-5H3 |
| InChIKey | FZOKPCLWAWULGE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|