C20H26N2O5S — CID 42676935
methyl 4-[2-[3-methoxypropyl(thiophene-2-carbonyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 42676935) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is methyl 4-[2-[3-methoxypropyl(thiophene-2-carbonyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[3-methoxypropyl(thiophene-2-carbonyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42676935 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | methyl 4-[2-[3-methoxypropyl(thiophene-2-carbonyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | COCCCN(CC(=O)c1c(C)c(C(=O)OC)n(C)c1C)C(=O)c1cccs1 |
| InChI | InChI=1S/C20H26N2O5S/c1-13-17(14(2)21(3)18(13)20(25)27-5)15(23)12-22(9-7-10-26-4)19(24)16-8-6-11-28-16/h6,8,11H,7,9-10,12H2,1-5H3 |
| InChIKey | PBJZPAGUTHLRAE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|