C18H29N3O5 — CID 42677063
methyl 4-[2-[ethylcarbamoyl(3-methoxypropyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 42677063) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl 4-[2-[ethylcarbamoyl(3-methoxypropyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[ethylcarbamoyl(3-methoxypropyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42677063 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | methyl 4-[2-[ethylcarbamoyl(3-methoxypropyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | CCNC(=O)N(CCCOC)CC(=O)c1c(C)c(C(=O)OC)n(C)c1C |
| InChI | InChI=1S/C18H29N3O5/c1-7-19-18(24)21(9-8-10-25-5)11-14(22)15-12(2)16(17(23)26-6)20(4)13(15)3/h7-11H2,1-6H3,(H,19,24) |
| InChIKey | ZMKGAEIBPYMQQB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|