C18H27NO4 — CID 42682347
[3-[cyclopropyl-[(2-methoxyphenyl)methyl]amino]-2-hydroxypropyl] butanoate (PubChem CID 42682347) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is [3-[cyclopropyl-[(2-methoxyphenyl)methyl]amino]-2-hydroxypropyl] butanoate.
| Compound Name | [3-[cyclopropyl-[(2-methoxyphenyl)methyl]amino]-2-hydroxypropyl] butanoate |
|---|---|
| PubChem CID | 42682347 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | [3-[cyclopropyl-[(2-methoxyphenyl)methyl]amino]-2-hydroxypropyl] butanoate |
| SMILES | CCCC(=O)OCC(O)CN(Cc1ccccc1OC)C1CC1 |
| InChI | InChI=1S/C18H27NO4/c1-3-6-18(21)23-13-16(20)12-19(15-9-10-15)11-14-7-4-5-8-17(14)22-2/h4-5,7-8,15-16,20H,3,6,9-13H2,1-2H3 |
| InChIKey | PKEWEIUAGYXOHF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |