C21H24ClN5O2 — CID 42685199
1-[5-amino-1-(2-chlorophenyl)-3-(4-methoxyphenyl)pyrazol-4-yl]-3-butan-2-ylurea (PubChem CID 42685199) has the molecular formula C21H24ClN5O2 and a molecular weight of 413.91 g/mol. Its IUPAC name is 1-[5-amino-1-(2-chlorophenyl)-3-(4-methoxyphenyl)pyrazol-4-yl]-3-butan-2-ylurea.
| Compound Name | 1-[5-amino-1-(2-chlorophenyl)-3-(4-methoxyphenyl)pyrazol-4-yl]-3-butan-2-ylurea |
|---|---|
| PubChem CID | 42685199 |
| Molecular Formula | C21H24ClN5O2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-[5-amino-1-(2-chlorophenyl)-3-(4-methoxyphenyl)pyrazol-4-yl]-3-butan-2-ylurea |
| SMILES | CCC(C)NC(=O)Nc1c(-c2ccc(OC)cc2)nn(-c2ccccc2Cl)c1N |
| InChI | InChI=1S/C21H24ClN5O2/c1-4-13(2)24-21(28)25-19-18(14-9-11-15(29-3)12-10-14)26-27(20(19)23)17-8-6-5-7-16(17)22/h5-13H,4,23H2,1-3H3,(H2,24,25,28) |
| InChIKey | NDUUXQGPUVYOBD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |