C22H20N4O4S — CID 42687986
1,3-benzodioxol-5-yl-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]methanone (PubChem CID 42687986) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]methanone |
|---|---|
| PubChem CID | 42687986 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCSc2nnc(COc3ccc4c(c3)CCC4)n21 |
| InChI | InChI=1S/C22H20N4O4S/c27-21(16-5-7-18-19(11-16)30-13-29-18)25-8-9-31-22-24-23-20(26(22)25)12-28-17-6-4-14-2-1-3-15(14)10-17/h4-7,10-11H,1-3,8-9,12-13H2 |
| InChIKey | PZIHOAYQHXYUPV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |