C19H17FN4O3S — CID 42687952
(3-fluorophenyl)-[3-[(3-methoxyphenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]methanone (PubChem CID 42687952) has the molecular formula C19H17FN4O3S and a molecular weight of 400.44 g/mol. Its IUPAC name is (3-fluorophenyl)-[3-[(3-methoxyphenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]methanone.
| Compound Name | (3-fluorophenyl)-[3-[(3-methoxyphenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]methanone |
|---|---|
| PubChem CID | 42687952 |
| Molecular Formula | C19H17FN4O3S |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (3-fluorophenyl)-[3-[(3-methoxyphenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]methanone |
| SMILES | COc1cccc(OCc2nnc3n2N(C(=O)c2cccc(F)c2)CCS3)c1 |
| InChI | InChI=1S/C19H17FN4O3S/c1-26-15-6-3-7-16(11-15)27-12-17-21-22-19-24(17)23(8-9-28-19)18(25)13-4-2-5-14(20)10-13/h2-7,10-11H,8-9,12H2,1H3 |
| InChIKey | NIAWPVXMXSDRHA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |