C18H13ClF2N4O2S — CID 42687971
[3-[(3-chlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-difluorophenyl)methanone (PubChem CID 42687971) has the molecular formula C18H13ClF2N4O2S and a molecular weight of 422.84 g/mol. Its IUPAC name is [3-[(3-chlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-difluorophenyl)methanone.
| Compound Name | [3-[(3-chlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 42687971 |
| Molecular Formula | C18H13ClF2N4O2S |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | [3-[(3-chlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)N1CCSc2nnc(COc3cccc(Cl)c3)n21 |
| InChI | InChI=1S/C18H13ClF2N4O2S/c19-12-2-1-3-15(8-12)27-10-16-22-23-18-25(16)24(4-5-28-18)17(26)11-6-13(20)9-14(21)7-11/h1-3,6-9H,4-5,10H2 |
| InChIKey | JUGWDDSUDJCMMO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |