C13H12Cl2N4O2S — CID 42688050
1-[3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]ethanone (PubChem CID 42688050) has the molecular formula C13H12Cl2N4O2S and a molecular weight of 359.24 g/mol. Its IUPAC name is 1-[3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]ethanone.
| Compound Name | 1-[3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]ethanone |
|---|---|
| PubChem CID | 42688050 |
| Molecular Formula | C13H12Cl2N4O2S |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 1-[3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]ethanone |
| SMILES | CC(=O)N1CCSc2nnc(COc3cc(Cl)ccc3Cl)n21 |
| InChI | InChI=1S/C13H12Cl2N4O2S/c1-8(20)18-4-5-22-13-17-16-12(19(13)18)7-21-11-6-9(14)2-3-10(11)15/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | YAICSXWKFIBAKD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |