C20H19F2N5O3S — CID 42876456
3-[(2,4-difluorophenoxy)methyl]-N-(2-phenoxyethyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxamide (PubChem CID 42876456) has the molecular formula C20H19F2N5O3S and a molecular weight of 447.47 g/mol. Its IUPAC name is 3-[(2,4-difluorophenoxy)methyl]-N-(2-phenoxyethyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxamide.
| Compound Name | 3-[(2,4-difluorophenoxy)methyl]-N-(2-phenoxyethyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxamide |
|---|---|
| PubChem CID | 42876456 |
| Molecular Formula | C20H19F2N5O3S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 3-[(2,4-difluorophenoxy)methyl]-N-(2-phenoxyethyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)N1CCSc2nnc(COc3ccc(F)cc3F)n21 |
| InChI | InChI=1S/C20H19F2N5O3S/c21-14-6-7-17(16(22)12-14)30-13-18-24-25-20-27(18)26(9-11-31-20)19(28)23-8-10-29-15-4-2-1-3-5-15/h1-7,12H,8-11,13H2,(H,23,28) |
| InChIKey | OTKBJKCHPAFEKB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|