C18H12F4N4O2S — CID 42688045
[3-[(2,4-difluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-difluorophenyl)methanone (PubChem CID 42688045) has the molecular formula C18H12F4N4O2S and a molecular weight of 424.38 g/mol. Its IUPAC name is [3-[(2,4-difluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-difluorophenyl)methanone.
| Compound Name | [3-[(2,4-difluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 42688045 |
| Molecular Formula | C18H12F4N4O2S |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | [3-[(2,4-difluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)N1CCSc2nnc(COc3ccc(F)cc3F)n21 |
| InChI | InChI=1S/C18H12F4N4O2S/c19-11-1-2-15(14(22)8-11)28-9-16-23-24-18-26(16)25(3-4-29-18)17(27)10-5-12(20)7-13(21)6-10/h1-2,5-8H,3-4,9H2 |
| InChIKey | NXZNSTHLJJPNCQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |