C21H21FN4O5S — CID 42875757
[3-[(3-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 42875757) has the molecular formula C21H21FN4O5S and a molecular weight of 460.49 g/mol. Its IUPAC name is [3-[(3-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [3-[(3-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 42875757 |
| Molecular Formula | C21H21FN4O5S |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [3-[(3-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCSc3nnc(COc4cccc(F)c4)n32)cc(OC)c1OC |
| InChI | InChI=1S/C21H21FN4O5S/c1-28-16-9-13(10-17(29-2)19(16)30-3)20(27)25-7-8-32-21-24-23-18(26(21)25)12-31-15-6-4-5-14(22)11-15/h4-6,9-11H,7-8,12H2,1-3H3 |
| InChIKey | RPTWVXHQXMSTND-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |