C20H27N5O3S — CID 42689987
N-(cyclohexylmethyl)-3-[(2-methoxyphenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxamide (PubChem CID 42689987) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-[(2-methoxyphenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-3-[(2-methoxyphenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxamide |
|---|---|
| PubChem CID | 42689987 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(cyclohexylmethyl)-3-[(2-methoxyphenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxamide |
| SMILES | COc1ccccc1OCc1nnc2n1N(C(=O)NCC1CCCCC1)CCS2 |
| InChI | InChI=1S/C20H27N5O3S/c1-27-16-9-5-6-10-17(16)28-14-18-22-23-20-25(18)24(11-12-29-20)19(26)21-13-15-7-3-2-4-8-15/h5-6,9-10,15H,2-4,7-8,11-14H2,1H3,(H,21,26) |
| InChIKey | OUTZLQARYSHLRT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |