C22H31N5O2 — CID 42690803
[4-(2-methoxyethyl)piperazin-1-yl]-[4-(4-methylpiperidin-1-yl)phthalazin-1-yl]methanone (PubChem CID 42690803) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is [4-(2-methoxyethyl)piperazin-1-yl]-[4-(4-methylpiperidin-1-yl)phthalazin-1-yl]methanone.
| Compound Name | [4-(2-methoxyethyl)piperazin-1-yl]-[4-(4-methylpiperidin-1-yl)phthalazin-1-yl]methanone |
|---|---|
| PubChem CID | 42690803 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | [4-(2-methoxyethyl)piperazin-1-yl]-[4-(4-methylpiperidin-1-yl)phthalazin-1-yl]methanone |
| SMILES | COCCN1CCN(C(=O)c2nnc(N3CCC(C)CC3)c3ccccc23)CC1 |
| InChI | InChI=1S/C22H31N5O2/c1-17-7-9-26(10-8-17)21-19-6-4-3-5-18(19)20(23-24-21)22(28)27-13-11-25(12-14-27)15-16-29-2/h3-6,17H,7-16H2,1-2H3 |
| InChIKey | NNHJGBBAOGIURP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |