C23H32N6O — CID 42878357
[4-(4-propan-2-ylpiperazin-1-yl)phthalazin-1-yl]-(4-prop-2-enylpiperazin-1-yl)methanone (PubChem CID 42878357) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is [4-(4-propan-2-ylpiperazin-1-yl)phthalazin-1-yl]-(4-prop-2-enylpiperazin-1-yl)methanone.
| Compound Name | [4-(4-propan-2-ylpiperazin-1-yl)phthalazin-1-yl]-(4-prop-2-enylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 42878357 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | [4-(4-propan-2-ylpiperazin-1-yl)phthalazin-1-yl]-(4-prop-2-enylpiperazin-1-yl)methanone |
| SMILES | C=CCN1CCN(C(=O)c2nnc(N3CCN(C(C)C)CC3)c3ccccc23)CC1 |
| InChI | InChI=1S/C23H32N6O/c1-4-9-26-10-12-29(13-11-26)23(30)21-19-7-5-6-8-20(19)22(25-24-21)28-16-14-27(15-17-28)18(2)3/h4-8,18H,1,9-17H2,2-3H3 |
| InChIKey | AIDGVOKTRVIATR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|