C19H18N3O3PS — CID 4269235
1-diphenoxyphosphoryl-3-(5-methyl-2-pyridinyl)thiourea (PubChem CID 4269235) has the molecular formula C19H18N3O3PS and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-diphenoxyphosphoryl-3-(5-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-diphenoxyphosphoryl-3-(5-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 4269235 |
| Molecular Formula | C19H18N3O3PS |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 1-diphenoxyphosphoryl-3-(5-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NP(=O)(Oc2ccccc2)Oc2ccccc2)nc1 |
| InChI | InChI=1S/C19H18N3O3PS/c1-15-12-13-18(20-14-15)21-19(27)22-26(23,24-16-8-4-2-5-9-16)25-17-10-6-3-7-11-17/h2-14H,1H3,(H2,20,21,22,23,27) |
| InChIKey | WDQMEFHBYBBLTE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|