C28H28N4O — CID 42692813
(5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-(4-benzylpiperidin-1-yl)methanone (PubChem CID 42692813) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-(4-benzylpiperidin-1-yl)methanone.
| Compound Name | (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-(4-benzylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 42692813 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-(4-benzylpiperidin-1-yl)methanone |
| SMILES | O=C(c1nc(Cc2ccccc2)n(-c2ccccc2)n1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H28N4O/c33-28(31-18-16-24(17-19-31)20-22-10-4-1-5-11-22)27-29-26(21-23-12-6-2-7-13-23)32(30-27)25-14-8-3-9-15-25/h1-15,24H,16-21H2 |
| InChIKey | MRCSTKQVEOBERW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |