About 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea
1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea (PubChem CID 42694847) has the molecular formula C23H21ClN4O
and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea |
| PubChem CID | 42694847 |
| Molecular Formula | C23H21ClN4O |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea |
| SMILES | Cc1ccn2c(NC(=O)Nc3ccc(Cl)cc3)c(CCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C23H21ClN4O/c1-16-13-14-28-21(15-16)26-20(12-7-17-5-3-2-4-6-17)22(28)27-23(29)25-19-10-8-18(24)9-11-19/h2-6,8-11,13-15H,7,12H2,1H3,(H2,25,27,29) |
| InChIKey | NBOUBDQDUCLHPR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea?
The IUPAC name of 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea (CID 42694847) is 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea.
What is the SMILES notation for 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea?
The canonical SMILES for 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea is Cc1ccn2c(NC(=O)Nc3ccc(Cl)cc3)c(CCc3ccccc3)nc2c1.
What is the InChIKey of 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea?
The InChIKey is NBOUBDQDUCLHPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21ClN4O/c1-16-13-14-28-21(15-16)26-20(12-7-17-5-3-2-4-6-17)22(28)27-23(29)25-19-10-8-18(24)9-11-19/h2-6,8-11,13-15H,7,12H2,1H3,(H2,25,27,29).
What are the key properties of 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea?
1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea has a molecular weight of 404.90 g/mol, XLogP of 5.73, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-3-[7-methyl-2-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]urea is sourced from PubChem (CID 42694847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).