C24H24ClNO3 — CID 42695710
4-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(1-phenylethyl)benzamide (PubChem CID 42695710) has the molecular formula C24H24ClNO3 and a molecular weight of 409.91 g/mol. Its IUPAC name is 4-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42695710 |
| Molecular Formula | C24H24ClNO3 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(1-phenylethyl)benzamide |
| SMILES | COc1ccc(CN(C(=O)c2ccc(Cl)cc2)C(C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H24ClNO3/c1-17(19-7-5-4-6-8-19)26(24(27)20-10-12-21(25)13-11-20)16-18-9-14-22(28-2)23(15-18)29-3/h4-15,17H,16H2,1-3H3 |
| InChIKey | UEBQRGADQMGXNN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |