C22H29NO3 — CID 55383274
N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-2-phenylpentanamide (PubChem CID 55383274) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-2-phenylpentanamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 55383274 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-2-phenylpentanamide |
| SMILES | CCCC(C(=O)N(CC)Cc1ccc(OC)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO3/c1-5-10-19(18-11-8-7-9-12-18)22(24)23(6-2)16-17-13-14-20(25-3)21(15-17)26-4/h7-9,11-15,19H,5-6,10,16H2,1-4H3 |
| InChIKey | BWUIGYKQZJBDMM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |