C24H27NO7 — CID 171990094
dimethyl 4-[[(3-acetyloxy-2-phenylpropanoyl)-ethylamino]methyl]benzene-1,2-dicarboxylate (PubChem CID 171990094) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is dimethyl 4-[[(3-acetyloxy-2-phenylpropanoyl)-ethylamino]methyl]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[[(3-acetyloxy-2-phenylpropanoyl)-ethylamino]methyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 171990094 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | dimethyl 4-[[(3-acetyloxy-2-phenylpropanoyl)-ethylamino]methyl]benzene-1,2-dicarboxylate |
| SMILES | CCN(Cc1ccc(C(=O)OC)c(C(=O)OC)c1)C(=O)C(COC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C24H27NO7/c1-5-25(22(27)21(15-32-16(2)26)18-9-7-6-8-10-18)14-17-11-12-19(23(28)30-3)20(13-17)24(29)31-4/h6-13,21H,5,14-15H2,1-4H3 |
| InChIKey | SIYSVSFYZLPGOF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|