C35H35NO3 — CID 42697713
N-(anthracen-9-ylmethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenylbutanamide (PubChem CID 42697713) has the molecular formula C35H35NO3 and a molecular weight of 517.67 g/mol. Its IUPAC name is N-(anthracen-9-ylmethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenylbutanamide.
| Compound Name | N-(anthracen-9-ylmethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 42697713 |
| Molecular Formula | C35H35NO3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N-(anthracen-9-ylmethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenylbutanamide |
| SMILES | CCC(C(=O)N(CCc1ccc(OC)c(OC)c1)Cc1c2ccccc2cc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C35H35NO3/c1-4-29(26-12-6-5-7-13-26)35(37)36(21-20-25-18-19-33(38-2)34(22-25)39-3)24-32-30-16-10-8-14-27(30)23-28-15-9-11-17-31(28)32/h5-19,22-23,29H,4,20-21,24H2,1-3H3 |
| InChIKey | GYIPQEKPMOUZGN-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|