C21H26ClN3O3S — CID 42696611
N-(1-benzylpiperidin-4-yl)-2-[(4-chlorophenyl)sulfonylamino]propanamide (PubChem CID 42696611) has the molecular formula C21H26ClN3O3S and a molecular weight of 435.98 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-[(4-chlorophenyl)sulfonylamino]propanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-[(4-chlorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 42696611 |
| Molecular Formula | C21H26ClN3O3S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-[(4-chlorophenyl)sulfonylamino]propanamide |
| SMILES | CC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26ClN3O3S/c1-16(24-29(27,28)20-9-7-18(22)8-10-20)21(26)23-19-11-13-25(14-12-19)15-17-5-3-2-4-6-17/h2-10,16,19,24H,11-15H2,1H3,(H,23,26) |
| InChIKey | JLVWJMJAZAUSLB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |