C23H30BrN3O3S — CID 42702862
N-(1-benzylpiperidin-4-yl)-2-[(4-bromophenyl)sulfonylamino]pentanamide (PubChem CID 42702862) has the molecular formula C23H30BrN3O3S and a molecular weight of 508.48 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-[(4-bromophenyl)sulfonylamino]pentanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-[(4-bromophenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 42702862 |
| Molecular Formula | C23H30BrN3O3S |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-[(4-bromophenyl)sulfonylamino]pentanamide |
| SMILES | CCCC(NS(=O)(=O)c1ccc(Br)cc1)C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30BrN3O3S/c1-2-6-22(26-31(29,30)21-11-9-19(24)10-12-21)23(28)25-20-13-15-27(16-14-20)17-18-7-4-3-5-8-18/h3-5,7-12,20,22,26H,2,6,13-17H2,1H3,(H,25,28) |
| InChIKey | CQCSWWFTSNZUDL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |