C24H24ClN3O — CID 42697640
3-(4-chlorophenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]-1-(2-pyridin-2-ylethyl)urea (PubChem CID 42697640) has the molecular formula C24H24ClN3O and a molecular weight of 405.93 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]-1-(2-pyridin-2-ylethyl)urea.
| Compound Name | 3-(4-chlorophenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]-1-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 42697640 |
| Molecular Formula | C24H24ClN3O |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]-1-(2-pyridin-2-ylethyl)urea |
| SMILES | C/C(=C\c1ccccc1)CN(CCc1ccccn1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClN3O/c1-19(17-20-7-3-2-4-8-20)18-28(16-14-22-9-5-6-15-26-22)24(29)27-23-12-10-21(25)11-13-23/h2-13,15,17H,14,16,18H2,1H3,(H,27,29)/b19-17+ |
| InChIKey | HBIBZKNTHPYVBS-HTXNQAPBSA-N |
| XLogP | 5.92 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |