C29H26N2O4 — CID 42697710
1-(anthracen-9-ylmethyl)-3-(2,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)urea (PubChem CID 42697710) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 1-(anthracen-9-ylmethyl)-3-(2,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)urea.
| Compound Name | 1-(anthracen-9-ylmethyl)-3-(2,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 42697710 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 1-(anthracen-9-ylmethyl)-3-(2,4-dimethoxyphenyl)-1-(furan-2-ylmethyl)urea |
| SMILES | COc1ccc(NC(=O)N(Cc2ccco2)Cc2c3ccccc3cc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C29H26N2O4/c1-33-22-13-14-27(28(17-22)34-2)30-29(32)31(18-23-10-7-15-35-23)19-26-24-11-5-3-8-20(24)16-21-9-4-6-12-25(21)26/h3-17H,18-19H2,1-2H3,(H,30,32) |
| InChIKey | GXPFQTKADAXCQB-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|