C24H30FNO2 — CID 42698622
2-ethyl-N-(4-fluorophenyl)-N-[(E)-3-(2-methoxyphenyl)prop-2-enyl]hexanamide (PubChem CID 42698622) has the molecular formula C24H30FNO2 and a molecular weight of 383.51 g/mol. Its IUPAC name is 2-ethyl-N-(4-fluorophenyl)-N-[(E)-3-(2-methoxyphenyl)prop-2-enyl]hexanamide.
| Compound Name | 2-ethyl-N-(4-fluorophenyl)-N-[(E)-3-(2-methoxyphenyl)prop-2-enyl]hexanamide |
|---|---|
| PubChem CID | 42698622 |
| Molecular Formula | C24H30FNO2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 2-ethyl-N-(4-fluorophenyl)-N-[(E)-3-(2-methoxyphenyl)prop-2-enyl]hexanamide |
| SMILES | CCCCC(CC)C(=O)N(C/C=C/c1ccccc1OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H30FNO2/c1-4-6-10-19(5-2)24(27)26(22-16-14-21(25)15-17-22)18-9-12-20-11-7-8-13-23(20)28-3/h7-9,11-17,19H,4-6,10,18H2,1-3H3/b12-9+ |
| InChIKey | DSKDPETZBRDGNC-FMIVXFBMSA-N |
| XLogP | 6.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |