C30H41N3O2 — CID 42698898
N-[3-(4-benzhydrylpiperazin-1-yl)-3-oxopropyl]-N-(2-methylpropyl)cyclopentanecarboxamide (PubChem CID 42698898) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is N-[3-(4-benzhydrylpiperazin-1-yl)-3-oxopropyl]-N-(2-methylpropyl)cyclopentanecarboxamide.
| Compound Name | N-[3-(4-benzhydrylpiperazin-1-yl)-3-oxopropyl]-N-(2-methylpropyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42698898 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | N-[3-(4-benzhydrylpiperazin-1-yl)-3-oxopropyl]-N-(2-methylpropyl)cyclopentanecarboxamide |
| SMILES | CC(C)CN(CCC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C30H41N3O2/c1-24(2)23-33(30(35)27-15-9-10-16-27)18-17-28(34)31-19-21-32(22-20-31)29(25-11-5-3-6-12-25)26-13-7-4-8-14-26/h3-8,11-14,24,27,29H,9-10,15-23H2,1-2H3 |
| InChIKey | RLEUUYBPFUELNW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |