C32H43N3O4 — CID 42699133
ethyl 4-[[3-(4-benzhydrylpiperazin-1-yl)-3-oxopropyl]-cyclohexylamino]-4-oxobutanoate (PubChem CID 42699133) has the molecular formula C32H43N3O4 and a molecular weight of 533.71 g/mol. Its IUPAC name is ethyl 4-[[3-(4-benzhydrylpiperazin-1-yl)-3-oxopropyl]-cyclohexylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[3-(4-benzhydrylpiperazin-1-yl)-3-oxopropyl]-cyclohexylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42699133 |
| Molecular Formula | C32H43N3O4 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | ethyl 4-[[3-(4-benzhydrylpiperazin-1-yl)-3-oxopropyl]-cyclohexylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(CCC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C32H43N3O4/c1-2-39-31(38)19-18-30(37)35(28-16-10-5-11-17-28)21-20-29(36)33-22-24-34(25-23-33)32(26-12-6-3-7-13-26)27-14-8-4-9-15-27/h3-4,6-9,12-15,28,32H,2,5,10-11,16-25H2,1H3 |
| InChIKey | UUHZRULIPLYHJK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |