C22H33ClN2O2 — CID 42700013
N-[(2-chlorophenyl)methyl]-3,5,5-trimethyl-N-(2-oxoazepan-3-yl)hexanamide (PubChem CID 42700013) has the molecular formula C22H33ClN2O2 and a molecular weight of 392.97 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3,5,5-trimethyl-N-(2-oxoazepan-3-yl)hexanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3,5,5-trimethyl-N-(2-oxoazepan-3-yl)hexanamide |
|---|---|
| PubChem CID | 42700013 |
| Molecular Formula | C22H33ClN2O2 |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3,5,5-trimethyl-N-(2-oxoazepan-3-yl)hexanamide |
| SMILES | CC(CC(=O)N(Cc1ccccc1Cl)C1CCCCNC1=O)CC(C)(C)C |
| InChI | InChI=1S/C22H33ClN2O2/c1-16(14-22(2,3)4)13-20(26)25(15-17-9-5-6-10-18(17)23)19-11-7-8-12-24-21(19)27/h5-6,9-10,16,19H,7-8,11-15H2,1-4H3,(H,24,27) |
| InChIKey | NZXLLFMYGTWRAS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |